CAS 71047-51-3 is the registry number for 1-(3-((4-Ethoxyphenyl)amino)-5-methyl-2,4-thiazolyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg.
1-[2-(4-ethoxyanilino)-4-methyl-1,3-thiazol-5-yl]ethanone (CAS 71047-51-3) is a chemical compound with the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. IUPAC name: 1-[2-(4-ethoxyanilino)-4-methyl-1,3-thiazol-5-yl]ethanone. InChIKey: SPROBMWPEYGRQV-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O2S |
|---|---|
| Molecular weight | 276.36 g/mol |
| IUPAC name | 1-[2-(4-ethoxyanilino)-4-methyl-1,3-thiazol-5-yl]ethanone |
| InChIKey | SPROBMWPEYGRQV-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)NC2=NC(=C(S2)C(=O)C)C |
Computed by PubChem (NCBI)