CAS 71083-64-2 is the registry number for 7-Methoxy-4-oxo-1,4-dihydroquinoline-3-carbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-methoxy-4-oxo-1H-quinoline-3-carbonitrile (CAS 71083-64-2) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 7-methoxy-4-oxo-1H-quinoline-3-carbonitrile. InChIKey: BRANBXSWAAPZNW-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 7-methoxy-4-oxo-1H-quinoline-3-carbonitrile |
| InChIKey | BRANBXSWAAPZNW-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)C(=CN2)C#N |
Computed by PubChem (NCBI)