CAS 711-23-9 is the registry number for 1,1,1-trifluoro-2-(4-fluorophenyl)propan-2-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,1,1-trifluoro-2-(4-fluorophenyl)propan-2-ol (CAS 711-23-9) is a chemical compound with the molecular formula C9H8F4O and a molecular weight of 208.15 g/mol. IUPAC name: 1,1,1-trifluoro-2-(4-fluorophenyl)propan-2-ol. InChIKey: NNJSYXUDNZVARC-UHFFFAOYSA-N.
| Molecular formula | C9H8F4O |
|---|---|
| Molecular weight | 208.15 g/mol |
| IUPAC name | 1,1,1-trifluoro-2-(4-fluorophenyl)propan-2-ol |
| InChIKey | NNJSYXUDNZVARC-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)