CAS 712-76-5 appears in our catalog under these names: 4–Phenylbenzylamine, [1,1'-Biphenyl]-4-ylmethanamine, >95.0%(GC)(T), 4-Phenylbenzylamine, 4-Phenylbenzylamine 98%, 4-Phenylbenzyl amine, 95%. Offered by: GLPBio, TCI, Biosynth, Ambeed, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 50g, 250mg.
(4-phenylphenyl)methanamine (CAS 712-76-5) is a chemical compound with the molecular formula C13H13N and a molecular weight of 183.25 g/mol. IUPAC name: (4-phenylphenyl)methanamine. InChIKey: RMSPOVPGDBDYKH-UHFFFAOYSA-N.
| Molecular formula | C13H13N |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | (4-phenylphenyl)methanamine |
| InChIKey | RMSPOVPGDBDYKH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CN |
Computed by PubChem (NCBI)