Products 712264-49-8
CAS 712264-49-8 is the registry number for 4-(4-(4-Chlorophenoxy)phenyl)thiazol-2-amine. Offered by: Chemat. Available pack sizes: 1g.
4-[4-(4-chlorophenoxy)phenyl]-1,3-thiazol-2-amine (CAS 712264-49-8) is a chemical compound with the molecular formula C15H11ClN2OS and a molecular weight of 302.8 g/mol. IUPAC name: 4-[4-(4-chlorophenoxy)phenyl]-1,3-thiazol-2-amine. InChIKey: GQIAWKVNYAQJMJ-UHFFFAOYSA-N.
| Molecular formula | C15H11ClN2OS |
|---|---|
| Molecular weight | 302.8 g/mol |
| IUPAC name | 4-[4-(4-chlorophenoxy)phenyl]-1,3-thiazol-2-amine |
| InChIKey | GQIAWKVNYAQJMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=N2)N)OC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)