Products 71274-97-0
CAS 71274-97-0 is the registry number for LY134046. Offered by: MedChemExpress. Available pack sizes: Get quote.
8,9-dichloro-2,3,4,5-tetrahydro-1H-2-benzazepine (CAS 71274-97-0) is a chemical compound with the molecular formula C10H11Cl2N and a molecular weight of 216.10 g/mol. IUPAC name: 8,9-dichloro-2,3,4,5-tetrahydro-1H-2-benzazepine. InChIKey: IADAQXMUWITWNG-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N |
|---|---|
| Molecular weight | 216.10 g/mol |
| IUPAC name | 8,9-dichloro-2,3,4,5-tetrahydro-1H-2-benzazepine |
| InChIKey | IADAQXMUWITWNG-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CNC1)C(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)