Products 713147-49-0
CAS 713147-49-0 is the registry number for tert-Butyl 4-((N'-hydroxycarbamimidoyl)methyl)piperidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 4-[(2Z)-2-amino-2-hydroxyiminoethyl]piperidine-1-carboxylate (CAS 713147-49-0) is a chemical compound with the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. IUPAC name: tert-butyl 4-[(2Z)-2-amino-2-hydroxyiminoethyl]piperidine-1-carboxylate. InChIKey: BEQDXPROLVMHPF-UHFFFAOYSA-N.
| Molecular formula | C12H23N3O3 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | tert-butyl 4-[(2Z)-2-amino-2-hydroxyiminoethyl]piperidine-1-carboxylate |
| InChIKey | BEQDXPROLVMHPF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C/C(=N/O)/N |
Computed by PubChem (NCBI)