CAS 71322-92-4 appears in our catalog under these names: 5-Methyl-8-quinoxalinesulfonyl Chloride, 5-Methylquinoline-8-sulfonyl chloride. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 0,1g, 0,05g, 0,25g, 1g, 0,5g.
5-methylquinoline-8-sulfonyl chloride (CAS 71322-92-4) is a chemical compound with the molecular formula C10H8ClNO2S and a molecular weight of 241.69 g/mol. IUPAC name: 5-methylquinoline-8-sulfonyl chloride. InChIKey: HHXKCMSAFXQGDW-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2S |
|---|---|
| Molecular weight | 241.69 g/mol |
| IUPAC name | 5-methylquinoline-8-sulfonyl chloride |
| InChIKey | HHXKCMSAFXQGDW-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC=NC2=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)