CAS 71369-81-8 appears in our catalog under these names: 2–(4–METHOXYPHENYLAMINO)–2–THIOXOACETAMIDE, 2-((4-Methoxyphenyl)amino)-2-thioxoacetamide, 95%, 95%, 2-((4-Methoxyphenyl)amino)-2-thioxoacetamide, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g.
2-(4-methoxyanilino)-2-sulfanylideneacetamide (CAS 71369-81-8) is a chemical compound with the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. IUPAC name: 2-(4-methoxyanilino)-2-sulfanylideneacetamide. InChIKey: FIVODOWKJKUEOQ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2S |
|---|---|
| Molecular weight | 210.26 g/mol |
| IUPAC name | 2-(4-methoxyanilino)-2-sulfanylideneacetamide |
| InChIKey | FIVODOWKJKUEOQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC(=S)C(=O)N |
Computed by PubChem (NCBI)