CAS 7141-88-0 is the registry number for Methyl 2-bromo-3-(4-methylphenyl)propanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-bromo-3-(4-methylphenyl)propanoate (CAS 7141-88-0) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: methyl 2-bromo-3-(4-methylphenyl)propanoate. InChIKey: GMIBCAWRTDYVQI-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | methyl 2-bromo-3-(4-methylphenyl)propanoate |
| InChIKey | GMIBCAWRTDYVQI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC(C(=O)OC)Br |
Computed by PubChem (NCBI)