Products 71444-83-2
CAS 71444-83-2 is the registry number for (S)-1,2,3,11a-Tetrahydro-9-hydroxy-5H-pyrrolo(2,1-c)(1,4)benzodiazepin-5-one. Offered by: TRC. Available pack sizes: 250mg.
(6aS)-4-hydroxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one (CAS 71444-83-2) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: (6aS)-4-hydroxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one. InChIKey: CRSSNYCWXMOYOF-QMMMGPOBSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | (6aS)-4-hydroxy-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| InChIKey | CRSSNYCWXMOYOF-QMMMGPOBSA-N |
| SMILES | C1C[C@H]2C=NC3=C(C=CC=C3O)C(=O)N2C1 |
Computed by PubChem (NCBI)