Products 71472-56-5
CAS 71472-56-5 is the registry number for (7-Methyl-2,3-dihydro-4H-benzo[b][1,4]oxazin-4-yl)(phenyl)methanone, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 50mg.
(7-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)-phenylmethanone (CAS 71472-56-5) is a chemical compound with the molecular formula C16H15NO2 and a molecular weight of 253.29 g/mol. IUPAC name: (7-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)-phenylmethanone. InChIKey: OIJZWSPEJVCOIS-UHFFFAOYSA-N.
| Molecular formula | C16H15NO2 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | (7-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)-phenylmethanone |
| InChIKey | OIJZWSPEJVCOIS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(CCO2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)