CAS 1020933-05-4 appears in our catalog under these names: 4-(1,2,3,4-Tetrahydroisoquinolin-2-yl)benzoic acid, 4-(1,2,3,4-Tetrahydroisoquinolin-2-yl)benzoic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 2,5g, 250mg, 5g, 1g, 10g, 100mg.
4-(3,4-dihydro-1H-isoquinolin-2-yl)benzoic acid (CAS 1020933-05-4) is a chemical compound with the molecular formula C16H15NO2 and a molecular weight of 253.29 g/mol. IUPAC name: 4-(3,4-dihydro-1H-isoquinolin-2-yl)benzoic acid. InChIKey: MLBXNTONPUZECI-UHFFFAOYSA-N.
| Molecular formula | C16H15NO2 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)benzoic acid |
| InChIKey | MLBXNTONPUZECI-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)