CAS 714962-04-6 appears in our catalog under these names: (6-Chloro-pyrimidin-4-yl)-(4-trifluoromethoxy-phenyl)-amine, 6-Chloro-N-(4-(trifluoromethoxy)phenyl)pyrimidin-4-amine, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 2,5g, 1g, 5g, 10g, 25g.
6-chloro-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine (CAS 714962-04-6) is a chemical compound with the molecular formula C11H7ClF3N3O and a molecular weight of 289.64 g/mol. IUPAC name: 6-chloro-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine. InChIKey: XQKICFGZSQFAOB-UHFFFAOYSA-N.
| Molecular formula | C11H7ClF3N3O |
|---|---|
| Molecular weight | 289.64 g/mol |
| IUPAC name | 6-chloro-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine |
| InChIKey | XQKICFGZSQFAOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=CC(=NC=N2)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)