CAS 71590-08-4 appears in our catalog under these names: 3-Methoxy-5-(methoxycarbonyl)benzoic acid, 95%, 3–Methoxy–5–(methoxycarbonyl)benzoic acid, 3-Methoxy-5-(methoxycarbonyl)benzoic acid, 95%, 95%, 3-methoxy-5-(methoxycarbonyl)benzoic acid, 95%(LC-MS),RG. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 100mg, 1g, 250mg, 5g, 10g.
3-methoxy-5-methoxycarbonylbenzoic acid (CAS 71590-08-4) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 3-methoxy-5-methoxycarbonylbenzoic acid. InChIKey: PMYOJVWSJTZGDJ-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | 3-methoxy-5-methoxycarbonylbenzoic acid |
| InChIKey | PMYOJVWSJTZGDJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(=O)OC)C(=O)O |
Computed by PubChem (NCBI)