CAS 71608-10-1 appears in our catalog under these names: 3,6-Dimethyl-2-nitrophenol, 97%, 3,6-Dimethyl-2-nitrophenol, 98%, 3,6–Dimethyl–2–nitrophenol, 3,6-Dimethyl-2-nitrophenol, >97%, >97%, 3,6-Dimethyl-2-nitrophenol, >97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
3,6-dimethyl-2-nitrophenol (CAS 71608-10-1) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 3,6-dimethyl-2-nitrophenol. InChIKey: VIQHHRZADKSPIM-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 3,6-dimethyl-2-nitrophenol |
| InChIKey | VIQHHRZADKSPIM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)