CAS 71629-86-2 appears in our catalog under these names: H-D-Don-OH, H–6–Diazo–5–oxo–D–Nle–OH, H-6-Diazo-5-oxo-D-Nle-OH, 6-Diazo-5-oxo-D-norleucine. Offered by: Creative Peptides, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 25mg, 2g, 1g, Get quote.
(2R)-2-amino-6-diazo-5-oxohexanoic acid (CAS 71629-86-2) is a chemical compound with the molecular formula C6H9N3O3 and a molecular weight of 171.15 g/mol. IUPAC name: (2R)-2-amino-6-diazo-5-oxohexanoic acid. InChIKey: YCWQAMGASJSUIP-RXMQYKEDSA-N.
| Molecular formula | C6H9N3O3 |
|---|---|
| Molecular weight | 171.15 g/mol |
| IUPAC name | (2R)-2-amino-6-diazo-5-oxohexanoic acid |
| InChIKey | YCWQAMGASJSUIP-RXMQYKEDSA-N |
| SMILES | C(CC(=O)C=[N+]=[N-])[C@H](C(=O)O)N |
Computed by PubChem (NCBI)