Products 716316-20-0
CAS 716316-20-0 is the registry number for tert-Butyl 4-nitro-1h-imidazole-1-carboxylate, 95%. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
Tert-butyl 4-nitroimidazole-1-carboxylate (CAS 716316-20-0) is a chemical compound with the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. IUPAC name: tert-butyl 4-nitroimidazole-1-carboxylate. InChIKey: OAUBECNLEORJTN-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O4 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | tert-butyl 4-nitroimidazole-1-carboxylate |
| InChIKey | OAUBECNLEORJTN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(N=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)