Products 683815-49-8
CAS 683815-49-8 appears in our catalog under these names: Ethyl 1-ethyl-5-nitro-1h-imidazole-2-carboxylate, 95%, Ethyl 1–ethyl–5–nitro–1H–imidazole–2–carboxylate, Ethyl 1-ethyl-5-nitro-1H-imidazole-2-carboxylate 97%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 1g, 100mg, 5g, 250mg.
Ethyl 1-ethyl-5-nitroimidazole-2-carboxylate (CAS 683815-49-8) is a chemical compound with the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. IUPAC name: ethyl 1-ethyl-5-nitroimidazole-2-carboxylate. InChIKey: DKFMSVHCQMMXOA-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O4 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | ethyl 1-ethyl-5-nitroimidazole-2-carboxylate |
| InChIKey | DKFMSVHCQMMXOA-UHFFFAOYSA-N |
| SMILES | CCN1C(=CN=C1C(=O)OCC)[N+](=O)[O-] |
Computed by PubChem (NCBI)