CAS 90091-28-4 is the registry number for 3-(3,5-Dimethyl-4-nitro-1h-pyrazol-1-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid (CAS 90091-28-4) is a chemical compound with the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. IUPAC name: 3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid. InChIKey: VGKCUVQITAZDAF-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O4 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoic acid |
| InChIKey | VGKCUVQITAZDAF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CCC(=O)O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)