CAS 716362-36-6 appears in our catalog under these names: 2-Amino-1H-benzo[d]imidazole-4-carboxylic acid, 95% (dihydrate), 95% (dihydrate), 2-amino-1H-1,3-benzodiazole-7-carboxylic acid, 97%, 2-Amino-1H-benzo[d]imidazole-4-carboxylic acid, 95% (dihydrate). Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-amino-1H-benzimidazole-4-carboxylic acid (CAS 716362-36-6) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 2-amino-1H-benzimidazole-4-carboxylic acid. InChIKey: ORQYHFUZYZIZKG-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 2-amino-1H-benzimidazole-4-carboxylic acid |
| InChIKey | ORQYHFUZYZIZKG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC(=N2)N)C(=O)O |
Computed by PubChem (NCBI)