Products 717-94-2
CAS 717-94-2 appears in our catalog under these names: 3-(3,5-Dimethoxyphenyl)propionic acid, 3-(3,5-Dimethoxyphenyl)propionic acid 98%, 3,5-Dimethoxyphenylpropionic Acid, 97%, 97%, 3-(3,5-Dimethoxyphenyl)propionic acid, 97%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 50g, 250g, 500g, 1000g, 250mg, 1g, 5g.
3-(3,5-dimethoxyphenyl)propanoic acid (CAS 717-94-2) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: 3-(3,5-dimethoxyphenyl)propanoic acid. InChIKey: LMBOJOXVLORKSQ-UHFFFAOYSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 3-(3,5-dimethoxyphenyl)propanoic acid |
| InChIKey | LMBOJOXVLORKSQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)CCC(=O)O)OC |
Computed by PubChem (NCBI)