Products 717106-72-4
CAS 717106-72-4 is the registry number for Methyl 2-(6-chloropyridin-3-yl)propanoate, 95%. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 2-(6-chloro-3-pyridinyl)propanoate (CAS 717106-72-4) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: methyl 2-(6-chloro-3-pyridinyl)propanoate. InChIKey: FMKOHOMSKOYASH-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | methyl 2-(6-chloro-3-pyridinyl)propanoate |
| InChIKey | FMKOHOMSKOYASH-UHFFFAOYSA-N |
| SMILES | CC(C1=CN=C(C=C1)Cl)C(=O)OC |
Computed by PubChem (NCBI)