Products 71809-03-5
CAS 71809-03-5 is the registry number for 2-(benzyloxy)-3,5-di-tert-butylbenzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,5-ditert-butyl-2-phenylmethoxybenzaldehyde (CAS 71809-03-5) is a chemical compound with the molecular formula C22H28O2 and a molecular weight of 324.5 g/mol. IUPAC name: 3,5-ditert-butyl-2-phenylmethoxybenzaldehyde. InChIKey: CJQPAECLRFFQQA-UHFFFAOYSA-N.
| Molecular formula | C22H28O2 |
|---|---|
| Molecular weight | 324.5 g/mol |
| IUPAC name | 3,5-ditert-butyl-2-phenylmethoxybenzaldehyde |
| InChIKey | CJQPAECLRFFQQA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)OCC2=CC=CC=C2)C=O |
Computed by PubChem (NCBI)