CAS 7181-48-8 is the registry number for N-Nitroso-(1S,2R)-ephedrine. Offered by: TRC. Available pack sizes: 250mg.
N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide (CAS 7181-48-8) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide. InChIKey: ZVTOLKAVCZXHFM-PSASIEDQSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-N-methylnitrous amide |
| InChIKey | ZVTOLKAVCZXHFM-PSASIEDQSA-N |
| SMILES | C[C@H]([C@H](C1=CC=CC=C1)O)N(C)N=O |
Computed by PubChem (NCBI)