CAS 71845-14-2 is the registry number for 3-(2-Chlorophenyl)-1h-pyrrole, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
3-(2-chlorophenyl)-1H-pyrrole (CAS 71845-14-2) is a chemical compound with the molecular formula C10H8ClN and a molecular weight of 177.63 g/mol. IUPAC name: 3-(2-chlorophenyl)-1H-pyrrole. InChIKey: BMEUPZMTSYBPLS-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-1H-pyrrole |
| InChIKey | BMEUPZMTSYBPLS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CNC=C2)Cl |
Computed by PubChem (NCBI)