CAS 71932-18-8 appears in our catalog under these names: 5-Formylbenzene-1,2,3-triyl triacetate, 95%, 3,4,5–Triacetoxybenzaldehyde, 3,4,5-Triacetoxybenzaldehyde. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 50mg, 1000mg, 500mg, 2000mg.
(2,3-diacetyloxy-5-formylphenyl) acetate (CAS 71932-18-8) is a chemical compound with the molecular formula C13H12O7 and a molecular weight of 280.23 g/mol. IUPAC name: (2,3-diacetyloxy-5-formylphenyl) acetate. InChIKey: MLPOXDZQEHKDMW-UHFFFAOYSA-N.
| Molecular formula | C13H12O7 |
|---|---|
| Molecular weight | 280.23 g/mol |
| IUPAC name | (2,3-diacetyloxy-5-formylphenyl) acetate |
| InChIKey | MLPOXDZQEHKDMW-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=CC(=C1OC(=O)C)OC(=O)C)C=O |
Computed by PubChem (NCBI)