CAS 96330-54-0 is the registry number for 5-Oxo-2-phenyl-1,3-dioxolane-4,4-diacetic Acid. Offered by: TRC. Available pack sizes: 5g.
2-[4-(carboxymethyl)-5-oxo-2-phenyl-1,3-dioxolan-4-yl]acetic acid (CAS 96330-54-0) is a chemical compound with the molecular formula C13H12O7 and a molecular weight of 280.23 g/mol. IUPAC name: 2-[4-(carboxymethyl)-5-oxo-2-phenyl-1,3-dioxolan-4-yl]acetic acid. InChIKey: OAWZNLHMZIEFFG-UHFFFAOYSA-N.
| Molecular formula | C13H12O7 |
|---|---|
| Molecular weight | 280.23 g/mol |
| IUPAC name | 2-[4-(carboxymethyl)-5-oxo-2-phenyl-1,3-dioxolan-4-yl]acetic acid |
| InChIKey | OAWZNLHMZIEFFG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2OC(=O)C(O2)(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)