CAS 802857-44-9 appears in our catalog under these names: Sodium Cromoglicate Impurity 8, Sodium Cromoglicate Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,3-dihydroxypropoxy)-4-oxochromene-2-carboxylic acid (CAS 802857-44-9) is a chemical compound with the molecular formula C13H12O7 and a molecular weight of 280.23 g/mol. IUPAC name: 5-(2,3-dihydroxypropoxy)-4-oxochromene-2-carboxylic acid. InChIKey: FKUSMBZXMBJTLD-UHFFFAOYSA-N.
| Molecular formula | C13H12O7 |
|---|---|
| Molecular weight | 280.23 g/mol |
| IUPAC name | 5-(2,3-dihydroxypropoxy)-4-oxochromene-2-carboxylic acid |
| InChIKey | FKUSMBZXMBJTLD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)OCC(CO)O)C(=O)C=C(O2)C(=O)O |
Computed by PubChem (NCBI)