Products 71969-25-0
CAS 71969-25-0 is the registry number for (4-Aminophenyl)(3,4-dimethylphenyl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(4-aminophenyl)-(3,4-dimethylphenyl)methanone (CAS 71969-25-0) is a chemical compound with the molecular formula C15H15NO and a molecular weight of 225.28 g/mol. IUPAC name: (4-aminophenyl)-(3,4-dimethylphenyl)methanone. InChIKey: YDKUTIXKMCAGFZ-UHFFFAOYSA-N.
| Molecular formula | C15H15NO |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | (4-aminophenyl)-(3,4-dimethylphenyl)methanone |
| InChIKey | YDKUTIXKMCAGFZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)C2=CC=C(C=C2)N)C |
Computed by PubChem (NCBI)