CAS 71998-99-7 is the registry number for 2-Butylimidazole-4,5-dicarboxylic Acid. Offered by: TRC. Available pack sizes: 500mg.
2-butyl-1H-imidazole-4,5-dicarboxylic acid (CAS 71998-99-7) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: 2-butyl-1H-imidazole-4,5-dicarboxylic acid. InChIKey: UFVLIGITZXQUON-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 2-butyl-1H-imidazole-4,5-dicarboxylic acid |
| InChIKey | UFVLIGITZXQUON-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC(=C(N1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)