CAS 72002-54-1 appears in our catalog under these names: D-1,2,3,4-Tetrahydronorharman-3-carboxylic acid, 95%, (R)–2,3,4,9–Tetrahydro–1H–pyrido(3,4–b)indole–3–carboxylic acid, H-D-Tpi-OH 98%, (R)-2,3,4,9-Tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid, 98%, 98%, (R)-2,3,4,9-TETRAHYDRO-1H-PYRIDO[3,4-B]INDOLE-3-CARBOXYLIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg.
(3R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid (CAS 72002-54-1) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: (3R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid. InChIKey: FSNCEEGOMTYXKY-SNVBAGLBSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | (3R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
| InChIKey | FSNCEEGOMTYXKY-SNVBAGLBSA-N |
| SMILES | C1[C@@H](NCC2=C1C3=CC=CC=C3N2)C(=O)O |
Computed by PubChem (NCBI)