CAS 72008-03-8 is the registry number for 2-Geranyl-4-isobutyrylphloroglucinol. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4,6-trihydroxyphenyl]-2-methylpropan-1-one (CAS 72008-03-8) is a chemical compound with the molecular formula C20H28O4 and a molecular weight of 332.4 g/mol. IUPAC name: 1-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4,6-trihydroxyphenyl]-2-methylpropan-1-one. InChIKey: TXDNBNXWWCEVMG-NTEUORMPSA-N.
| Molecular formula | C20H28O4 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 1-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4,6-trihydroxyphenyl]-2-methylpropan-1-one |
| InChIKey | TXDNBNXWWCEVMG-NTEUORMPSA-N |
| SMILES | CC(C)C(=O)C1=C(C=C(C(=C1O)C/C=C(\C)/CCC=C(C)C)O)O |
Computed by PubChem (NCBI)