Products 721929-81-3
CAS 721929-81-3 is the registry number for tert-Butyl (tert-butoxycarbonyl)(4-methylpyridin-2-yl)carbamate, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(4-methyl-2-pyridinyl)carbamate (CAS 721929-81-3) is a chemical compound with the molecular formula C16H24N2O4 and a molecular weight of 308.37 g/mol. IUPAC name: tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(4-methyl-2-pyridinyl)carbamate. InChIKey: MWCNPXJJJFSYAR-UHFFFAOYSA-N.
| Molecular formula | C16H24N2O4 |
|---|---|
| Molecular weight | 308.37 g/mol |
| IUPAC name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(4-methyl-2-pyridinyl)carbamate |
| InChIKey | MWCNPXJJJFSYAR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)