CAS 721970-24-7 appears in our catalog under these names: Acetamide,n-[3-amino-1-naphthyl]-, 95%, N-(3-Aminonaphthalen-1-yl)acetamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 250mg.
N-(3-aminonaphthalen-1-yl)acetamide (CAS 721970-24-7) is a chemical compound with the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. IUPAC name: N-(3-aminonaphthalen-1-yl)acetamide. InChIKey: PJYZGMFZGBKNMN-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | N-(3-aminonaphthalen-1-yl)acetamide |
| InChIKey | PJYZGMFZGBKNMN-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=CC2=CC=CC=C21)N |
Computed by PubChem (NCBI)