CAS 722-97-4 appears in our catalog under these names: Oseltamivir Impurity 26, Oseltamivir Impurity 68, Oseltamivir impurity 68, 98.0%, 5,5-Diallyl-1,3-dimethylpyrimidine-2,4,6(1H,3H,5H)-trione (Oseltamivir Impurity), 98%. Offered by: Chemat Brand, MedChemExpress, Fluorochem. Available pack sizes: on request, 100 mg, 5 mg, 25 mg, 10 mg, 50 mg, 100mg, 250mg.
1,3-dimethyl-5,5-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione (CAS 722-97-4) is a chemical compound with the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. IUPAC name: 1,3-dimethyl-5,5-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione. InChIKey: MCTNRBUJWLUDJG-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O3 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 1,3-dimethyl-5,5-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione |
| InChIKey | MCTNRBUJWLUDJG-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(C(=O)N(C1=O)C)(CC=C)CC=C |
Computed by PubChem (NCBI)