Products 722471-02-5
CAS 722471-02-5 is the registry number for 2-Amino-2-oxoethyl 2-amino-4-chlorobenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-amino-2-oxoethyl) 2-amino-4-chlorobenzoate (CAS 722471-02-5) is a chemical compound with the molecular formula C9H9ClN2O3 and a molecular weight of 228.63 g/mol. IUPAC name: (2-amino-2-oxoethyl) 2-amino-4-chlorobenzoate. InChIKey: RZDXUTPGNATBQC-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O3 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | (2-amino-2-oxoethyl) 2-amino-4-chlorobenzoate |
| InChIKey | RZDXUTPGNATBQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)N)C(=O)OCC(=O)N |
Computed by PubChem (NCBI)