CAS 7229-69-8 is the registry number for Dermocybin. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,3,4,5-tetrahydroxy-2-methoxy-7-methylanthracene-9,10-dione (CAS 7229-69-8) is a chemical compound with the molecular formula C16H12O7 and a molecular weight of 316.26 g/mol. IUPAC name: 1,3,4,5-tetrahydroxy-2-methoxy-7-methylanthracene-9,10-dione. InChIKey: WZDHOIZUFUBGHK-UHFFFAOYSA-N.
| Molecular formula | C16H12O7 |
|---|---|
| Molecular weight | 316.26 g/mol |
| IUPAC name | 1,3,4,5-tetrahydroxy-2-methoxy-7-methylanthracene-9,10-dione |
| InChIKey | WZDHOIZUFUBGHK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C(=C(C(=C3O)O)OC)O |
Computed by PubChem (NCBI)