CAS 723755-74-6 is the registry number for 2,4-Dimethylphenyl methanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,4-dimethylphenyl) methanesulfonate (CAS 723755-74-6) is a chemical compound with the molecular formula C9H12O3S and a molecular weight of 200.26 g/mol. IUPAC name: (2,4-dimethylphenyl) methanesulfonate. InChIKey: IEEWDXMYFCUFFF-UHFFFAOYSA-N.
| Molecular formula | C9H12O3S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | (2,4-dimethylphenyl) methanesulfonate |
| InChIKey | IEEWDXMYFCUFFF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OS(=O)(=O)C)C |
Computed by PubChem (NCBI)