Products 723759-65-7

CAS 723759-65-7 is the registry number for 2,3-Dimethylphenyl methanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2,3-dimethylphenyl) methanesulfonate (CAS 723759-65-7) is a chemical compound with the molecular formula C9H12O3S and a molecular weight of 200.26 g/mol. IUPAC name: (2,3-dimethylphenyl) methanesulfonate. InChIKey: IUACRZJPTISRDZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12O3S
Molecular weight200.26 g/mol
IUPAC name(2,3-dimethylphenyl) methanesulfonate
InChIKeyIUACRZJPTISRDZ-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)OS(=O)(=O)C)C

Computed by PubChem (NCBI)