Products 72472-29-8
CAS 72472-29-8 is the registry number for 9-Bromo-6,7,8,9-tetrahydro-5H-benzo(7)annulen-5-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
9-bromo-6,7,8,9-tetrahydrobenzo[7]annulen-5-one (CAS 72472-29-8) is a chemical compound with the molecular formula C11H11BrO and a molecular weight of 239.11 g/mol. IUPAC name: 9-bromo-6,7,8,9-tetrahydrobenzo[7]annulen-5-one. InChIKey: HZPXWGZCCZHHFH-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO |
|---|---|
| Molecular weight | 239.11 g/mol |
| IUPAC name | 9-bromo-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
| InChIKey | HZPXWGZCCZHHFH-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C2C(=O)C1)Br |
Computed by PubChem (NCBI)