CAS 724762-77-0 is the registry number for Rel-ethyl (1R,3r,5S)-3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (1R,5S)-3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate (CAS 724762-77-0) is a chemical compound with the molecular formula C10H18N2O2 and a molecular weight of 198.26 g/mol. IUPAC name: ethyl (1R,5S)-3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate. InChIKey: YXJPAZXYCIOTIV-CBLAIPOGSA-N.
| Molecular formula | C10H18N2O2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | ethyl (1R,5S)-3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | YXJPAZXYCIOTIV-CBLAIPOGSA-N |
| SMILES | CCOC(=O)N1[C@@H]2CC[C@H]1CC(C2)N |
Computed by PubChem (NCBI)