CAS 724787-53-5 is the registry number for (3R,4R)-Benzyl 4-((tert-butoxycarbonyl)amino)-3-hydroxypiperidine-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Benzyl (3R,4R)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate (CAS 724787-53-5) is a chemical compound with the molecular formula C18H26N2O5 and a molecular weight of 350.4 g/mol. IUPAC name: benzyl (3R,4R)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate. InChIKey: PYXBJXCKGMSJMY-HUUCEWRRSA-N.
| Molecular formula | C18H26N2O5 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | benzyl (3R,4R)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-1-carboxylate |
| InChIKey | PYXBJXCKGMSJMY-HUUCEWRRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(C[C@H]1O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)