Products 72576-14-8

CAS 72576-14-8 is the registry number for Hexazinone metabolite E. Offered by: Dr. Ehrenstorfer, Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

1-(4-hydroxycyclohexyl)-3-methyl-1,3,5-triazinane-2,4,6-trione (CAS 72576-14-8) is a chemical compound with the molecular formula C10H15N3O4 and a molecular weight of 241.24 g/mol. IUPAC name: 1-(4-hydroxycyclohexyl)-3-methyl-1,3,5-triazinane-2,4,6-trione. InChIKey: XWGDZLCXIRAUEM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15N3O4
Molecular weight241.24 g/mol
IUPAC name1-(4-hydroxycyclohexyl)-3-methyl-1,3,5-triazinane-2,4,6-trione
InChIKeyXWGDZLCXIRAUEM-UHFFFAOYSA-N
SMILESCN1C(=O)NC(=O)N(C1=O)C2CCC(CC2)O

Computed by PubChem (NCBI)