CAS 726-42-1 appears in our catalog under these names: 1,3–Di–p–tolylcarbodiimide, N,N′-Methanetetraylbis[4-methylbenzenamine], 95%, 95%, 1,3-Di-p-tolylcarbodiimide, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
N,N'-bis(4-methylphenyl)methanediimine (CAS 726-42-1) is a chemical compound with the molecular formula C15H14N2 and a molecular weight of 222.28 g/mol. IUPAC name: N,N'-bis(4-methylphenyl)methanediimine. InChIKey: BOSWPVRACYJBSJ-UHFFFAOYSA-N.
| Molecular formula | C15H14N2 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | N,N'-bis(4-methylphenyl)methanediimine |
| InChIKey | BOSWPVRACYJBSJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N=C=NC2=CC=C(C=C2)C |
Computed by PubChem (NCBI)