CAS 72617-81-3 appears in our catalog under these names: 5-Nitro-2-(2,2,2-trifluoroethoxy)pyridine, 97%, 5-nitro-2-(2,2,2-trifluoroethoxy)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 25g, 5g, 0,5g.
5-nitro-2-(2,2,2-trifluoroethoxy)pyridine (CAS 72617-81-3) is a chemical compound with the molecular formula C7H5F3N2O3 and a molecular weight of 222.12 g/mol. IUPAC name: 5-nitro-2-(2,2,2-trifluoroethoxy)pyridine. InChIKey: INIFPOGCBCXTPR-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O3 |
|---|---|
| Molecular weight | 222.12 g/mol |
| IUPAC name | 5-nitro-2-(2,2,2-trifluoroethoxy)pyridine |
| InChIKey | INIFPOGCBCXTPR-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1[N+](=O)[O-])OCC(F)(F)F |
Computed by PubChem (NCBI)