CAS 72633-64-8 is the registry number for Niflumic Acid EP Impurity B. Offered by: Mikromol. Available pack sizes: 25mg, 100mg.
2-oxo-N-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carboxamide (CAS 72633-64-8) is a chemical compound with the molecular formula C13H9F3N2O2 and a molecular weight of 282.22 g/mol. IUPAC name: 2-oxo-N-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carboxamide. InChIKey: HRAILYWEUPEYQL-UHFFFAOYSA-N.
| Molecular formula | C13H9F3N2O2 |
|---|---|
| Molecular weight | 282.22 g/mol |
| IUPAC name | 2-oxo-N-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carboxamide |
| InChIKey | HRAILYWEUPEYQL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=CC=CNC2=O)C(F)(F)F |
Computed by PubChem (NCBI)