Products 72633-64-8

CAS 72633-64-8 is the registry number for Niflumic Acid EP Impurity B. Offered by: Mikromol. Available pack sizes: 25mg, 100mg.

Structural formula: {0} (CAS {1})

2-oxo-N-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carboxamide (CAS 72633-64-8) is a chemical compound with the molecular formula C13H9F3N2O2 and a molecular weight of 282.22 g/mol. IUPAC name: 2-oxo-N-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carboxamide. InChIKey: HRAILYWEUPEYQL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9F3N2O2
Molecular weight282.22 g/mol
IUPAC name2-oxo-N-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carboxamide
InChIKeyHRAILYWEUPEYQL-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)NC(=O)C2=CC=CNC2=O)C(F)(F)F

Computed by PubChem (NCBI)