Products 72661-75-7
CAS 72661-75-7 appears in our catalog under these names: Methyl-d3- 2,3,4-Tri-O-acetyl-Beta-D-glucuronic Acid Methyl Ester, Methyl-d3- 2,3,4-Tri-O-acetyl-b-D-glucuronic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
Methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(trideuteriomethoxy)oxane-2-carboxylate (CAS 72661-75-7) is a chemical compound with the molecular formula C14H20O10 and a molecular weight of 351.32 g/mol. IUPAC name: methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(trideuteriomethoxy)oxane-2-carboxylate. InChIKey: WQZLHCDEZYULJJ-CBEVRSNFSA-N.
| Molecular formula | C14H20O10 |
|---|---|
| Molecular weight | 351.32 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-(trideuteriomethoxy)oxane-2-carboxylate |
| InChIKey | WQZLHCDEZYULJJ-CBEVRSNFSA-N |
| SMILES | [2H]C([2H])([2H])O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)C(=O)OC)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)