Products 7267-40-5
CAS 7267-40-5 is the registry number for 4,6-Dimethoxy-2-benzothiazolecarbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4,6-dimethoxy-1,3-benzothiazole-2-carbonitrile (CAS 7267-40-5) is a chemical compound with the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. IUPAC name: 4,6-dimethoxy-1,3-benzothiazole-2-carbonitrile. InChIKey: DHLBNMHRYBZROD-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2S |
|---|---|
| Molecular weight | 220.25 g/mol |
| IUPAC name | 4,6-dimethoxy-1,3-benzothiazole-2-carbonitrile |
| InChIKey | DHLBNMHRYBZROD-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1)SC(=N2)C#N)OC |
Computed by PubChem (NCBI)