CAS 7270-63-5 appears in our catalog under these names: 5-Diazomeldrum's acid, 98%, 5–Diazo–2,2–dimethyl–1,3–dioxane–4,6–dione, 5-Diazo-2,2-dimethyl-1,3-dioxane-4,6-dione, >98.0%(HPLC), 5-Diazo-2,2-dimethyl-1,3-dioxane-4,6-dione, ≥98%(HPLC), ≥98%(HPLC). Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g.
5-diazo-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 7270-63-5) is a chemical compound with the molecular formula C6H6N2O4 and a molecular weight of 170.12 g/mol. IUPAC name: 5-diazo-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: YRCVEMYVKSXPLM-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4 |
|---|---|
| Molecular weight | 170.12 g/mol |
| IUPAC name | 5-diazo-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | YRCVEMYVKSXPLM-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=[N+]=[N-])C(=O)O1)C |
Computed by PubChem (NCBI)